2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride
Modify Date: 2025-11-01 12:02:47
![2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride Structure](https://www.chemsrc.com/extcaspic/485/2228811-86-5.png)
2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride structure
|
Common Name | 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2228811-86-5 | Molecular Weight | 204.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13FO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13FO2S |
|---|---|
| Molecular Weight | 204.26 |
| InChIKey | XNSLTPNMUVOHSI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)CCC1CC2C=CC1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride? |
| A: The English name of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride is 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride. |
| Q: What is the CAS number of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride? |
| A: CAS number of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride is 2228811-86-5. |
| Q: What is the SMILES notation of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride? |
| A: SMILES notation of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride is O=S(=O)(F)CCC1CC2C=CC1C2. |
| Q: What is the molecular formula of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride? |
| A: Molecular formula of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride is C9H13FO2S. |
| Q: What is the molecular weight of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride? |
| A: Molecular weight of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride is 204.26. |
| Q: What is the Chinese name of 2228811-86-5? |
| A: Chinese name of 2228811-86-5 is 2228811-86-5. |
| Q: What is the InChIKey of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride? |
| A: InChIKey of 2-{Bicyclo[2.2.1]hept-5-en-2-yl}ethane-1-sulfonyl fluoride is XNSLTPNMUVOHSI-UHFFFAOYSA-N. |