3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole
Modify Date: 2025-10-23 18:22:24
![3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole Structure](https://www.chemsrc.com/extcaspic/022/2228833-94-9.png)
3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole structure
|
Common Name | 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 2228833-94-9 | Molecular Weight | 194.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18N2O |
|---|---|
| Molecular Weight | 194.27 |
| InChIKey | WQECBBYJCQNLAH-UHFFFAOYSA-N |
| SMILES | COC1(Cc2cc(C)[nH]c2C)CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole? |
| A: Molecular weight of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole is 194.27. |
| Q: What is the InChIKey of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole? |
| A: InChIKey of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole is WQECBBYJCQNLAH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole? |
| A: Molecular formula of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole is C11H18N2O. |
| Q: What is the English name of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole? |
| A: The English name of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole is 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole. |
| Q: What is the SMILES notation of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole? |
| A: SMILES notation of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole is COC1(Cc2cc(C)[nH]c2C)CNC1. |
| Q: What is the Chinese name of 2228833-94-9? |
| A: Chinese name of 2228833-94-9 is 2228833-94-9. |
| Q: What is the CAS number of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole? |
| A: CAS number of 3-[(3-methoxyazetidin-3-yl)methyl]-2,5-dimethyl-1H-pyrrole is 2228833-94-9. |