2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline
Modify Date: 2025-09-17 19:59:18
2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline structure
|
Common Name | 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 2228872-75-9 | Molecular Weight | 224.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21FN2 |
|---|---|
| Molecular Weight | 224.32 |
| InChIKey | TVWCATQGOKFMCN-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(F)cc1CC(C)(C)CN |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline? |
| A: Molecular formula of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline is C13H21FN2. |
| Q: What is the SMILES notation of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline? |
| A: SMILES notation of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline is CN(C)c1ccc(F)cc1CC(C)(C)CN. |
| Q: What is the Chinese name of 2228872-75-9? |
| A: Chinese name of 2228872-75-9 is 2228872-75-9. |
| Q: What is the InChIKey of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline? |
| A: InChIKey of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline is TVWCATQGOKFMCN-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline? |
| A: The English name of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline is 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline. |
| Q: What is the molecular weight of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline? |
| A: Molecular weight of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline is 224.32. |
| Q: What is the CAS number of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline? |
| A: CAS number of 2-(3-amino-2,2-dimethylpropyl)-4-fluoro-N,N-dimethylaniline is 2228872-75-9. |