Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate
Modify Date: 2025-08-28 12:26:37
Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate structure
|
Common Name | Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 2228928-92-3 | Molecular Weight | 228.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24O3 |
|---|---|
| Molecular Weight | 228.33 |
| InChIKey | SOKMQCBYROJVGG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)C(C)(C)CC1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate? |
| A: The English name of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate is Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate. |
| Q: What is the InChIKey of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate? |
| A: InChIKey of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate is SOKMQCBYROJVGG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate? |
| A: SMILES notation of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate is COC(=O)C(O)C(C)(C)CC1CCCCC1. |
| Q: What is the molecular weight of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate? |
| A: Molecular weight of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate is 228.33. |
| Q: What is the Chinese name of 2228928-92-3? |
| A: Chinese name of 2228928-92-3 is 2228928-92-3. |
| Q: What is the molecular formula of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate? |
| A: Molecular formula of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate is C13H24O3. |
| Q: What is the CAS number of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate? |
| A: CAS number of Methyl 4-cyclohexyl-2-hydroxy-3,3-dimethylbutanoate is 2228928-92-3. |