{1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol
Modify Date: 2025-10-07 20:23:10
![{1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol Structure](https://www.chemsrc.com/extcaspic/390/2228958-35-6.png)
{1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol structure
|
Common Name | {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol | ||
|---|---|---|---|---|
| CAS Number | 2228958-35-6 | Molecular Weight | 208.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20N2O |
|---|---|
| Molecular Weight | 208.30 |
| InChIKey | XWIYJLYOMSTWHN-UHFFFAOYSA-N |
| SMILES | CCn1nc(C)c(CC2(CO)CC2)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol? |
| A: The English name of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol is {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol. |
| Q: What is the molecular weight of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol? |
| A: Molecular weight of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol is 208.30. |
| Q: What is the SMILES notation of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol? |
| A: SMILES notation of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol is CCn1nc(C)c(CC2(CO)CC2)c1C. |
| Q: What is the Chinese name of 2228958-35-6? |
| A: Chinese name of 2228958-35-6 is 2228958-35-6. |
| Q: What is the CAS number of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol? |
| A: CAS number of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol is 2228958-35-6. |
| Q: What is the molecular formula of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol? |
| A: Molecular formula of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol is C12H20N2O. |
| Q: What is the InChIKey of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol? |
| A: InChIKey of {1-[(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]cyclopropyl}methanol is XWIYJLYOMSTWHN-UHFFFAOYSA-N. |