(2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride structure
|
Common Name | (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2228977-59-9 | Molecular Weight | 224.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6ClFN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H6ClFN2O2S |
|---|---|
| Molecular Weight | 224.64 |
| InChIKey | ZRDQSAFSNIUMCC-UHFFFAOYSA-N |
| SMILES | Cc1cc(CS(=O)(=O)F)nc(Cl)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride? |
| A: Molecular weight of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride is 224.64. |
| Q: What is the InChIKey of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride? |
| A: InChIKey of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride is ZRDQSAFSNIUMCC-UHFFFAOYSA-N. |
| Q: What is the English name of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride? |
| A: The English name of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride is (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride. |
| Q: What is the SMILES notation of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride? |
| A: SMILES notation of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride is Cc1cc(CS(=O)(=O)F)nc(Cl)n1. |
| Q: What is the Chinese name of 2228977-59-9? |
| A: Chinese name of 2228977-59-9 is 2228977-59-9. |
| Q: What is the molecular formula of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride? |
| A: Molecular formula of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride is C6H6ClFN2O2S. |
| Q: What is the CAS number of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride? |
| A: CAS number of (2-Chloro-6-methylpyrimidin-4-yl)methanesulfonyl fluoride is 2228977-59-9. |