{1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol
Modify Date: 2025-09-17 21:53:02
![{1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol Structure](https://www.chemsrc.com/extcaspic/371/2228978-64-9.png)
{1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol structure
|
Common Name | {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol | ||
|---|---|---|---|---|
| CAS Number | 2228978-64-9 | Molecular Weight | 230.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18N2O |
|---|---|
| Molecular Weight | 230.31 |
| InChIKey | WROQXIAAAXAFKV-UHFFFAOYSA-N |
| SMILES | OCC1(CCc2nc3ccccc3[nH]2)CCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228978-64-9? |
| A: Chinese name of 2228978-64-9 is 2228978-64-9. |
| Q: What is the SMILES notation of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol? |
| A: SMILES notation of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol is OCC1(CCc2nc3ccccc3[nH]2)CCC1. |
| Q: What is the molecular formula of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol? |
| A: Molecular formula of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol is C14H18N2O. |
| Q: What is the InChIKey of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol? |
| A: InChIKey of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol is WROQXIAAAXAFKV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol? |
| A: Molecular weight of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol is 230.31. |
| Q: What is the English name of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol? |
| A: The English name of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol is {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol. |
| Q: What is the CAS number of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol? |
| A: CAS number of {1-[2-(1H-1,3-benzodiazol-2-yl)ethyl]cyclobutyl}methanol is 2228978-64-9. |