[4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine
Modify Date: 2026-08-29 18:30:15
![[4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine Structure](https://www.chemsrc.com/extcaspic/271/2228981-30-2.png)
[4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine structure
|
Common Name | [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2228981-30-2 | Molecular Weight | 249.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21F2NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21F2NS |
|---|---|
| Molecular Weight | 249.37 |
| InChIKey | LJXMISDFNDXXCN-UHFFFAOYSA-N |
| SMILES | NCC1(C2CCCSC2)CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine? |
| A: The English name of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine is [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine. |
| Q: What is the molecular weight of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine? |
| A: Molecular weight of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine is 249.37. |
| Q: What is the InChIKey of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine? |
| A: InChIKey of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine is LJXMISDFNDXXCN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228981-30-2? |
| A: Chinese name of 2228981-30-2 is 2228981-30-2. |
| Q: What is the SMILES notation of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine? |
| A: SMILES notation of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine is NCC1(C2CCCSC2)CCC(F)(F)CC1. |
| Q: What is the CAS number of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine? |
| A: CAS number of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine is 2228981-30-2. |
| Q: What is the molecular formula of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine? |
| A: Molecular formula of [4,4-Difluoro-1-(thian-3-yl)cyclohexyl]methanamine is C12H21F2NS. |