[1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine
Modify Date: 2025-10-25 09:01:12
![[1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine Structure](https://www.chemsrc.com/extcaspic/291/2228985-10-0.png)
[1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine structure
|
Common Name | [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2228985-10-0 | Molecular Weight | 252.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9Cl2F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9Cl2F2N |
|---|---|
| Molecular Weight | 252.08 |
| InChIKey | ZDYYLZRNCZVXAG-UHFFFAOYSA-N |
| SMILES | NCC1(c2cc(Cl)cc(Cl)c2)CC1(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine? |
| A: Molecular formula of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine is C10H9Cl2F2N. |
| Q: What is the English name of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine? |
| A: The English name of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine is [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine. |
| Q: What is the molecular weight of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine? |
| A: Molecular weight of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine is 252.08. |
| Q: What is the CAS number of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine? |
| A: CAS number of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine is 2228985-10-0. |
| Q: What is the Chinese name of 2228985-10-0? |
| A: Chinese name of 2228985-10-0 is 2228985-10-0. |
| Q: What is the SMILES notation of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine? |
| A: SMILES notation of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine is NCC1(c2cc(Cl)cc(Cl)c2)CC1(F)F. |
| Q: What is the InChIKey of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine? |
| A: InChIKey of [1-(3,5-Dichlorophenyl)-2,2-difluorocyclopropyl]methanamine is ZDYYLZRNCZVXAG-UHFFFAOYSA-N. |