[4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine
Modify Date: 2025-09-17 18:06:03
![[4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine Structure](https://www.chemsrc.com/extcaspic/294/2228991-12-4.png)
[4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine structure
|
Common Name | [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2228991-12-4 | Molecular Weight | 265.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17F2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17F2N3 |
|---|---|
| Molecular Weight | 265.30 |
| InChIKey | FERGDVINPIRUDR-UHFFFAOYSA-N |
| SMILES | NCC1(c2[nH]nc3ccccc23)CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine? |
| A: Molecular weight of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine is 265.30. |
| Q: What is the English name of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine? |
| A: The English name of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine is [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine. |
| Q: What is the molecular formula of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine? |
| A: Molecular formula of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine is C14H17F2N3. |
| Q: What is the CAS number of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine? |
| A: CAS number of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine is 2228991-12-4. |
| Q: What is the SMILES notation of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine? |
| A: SMILES notation of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine is NCC1(c2[nH]nc3ccccc23)CCC(F)(F)CC1. |
| Q: What is the Chinese name of 2228991-12-4? |
| A: Chinese name of 2228991-12-4 is 2228991-12-4. |
| Q: What is the InChIKey of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine? |
| A: InChIKey of [4,4-difluoro-1-(1H-indazol-3-yl)cyclohexyl]methanamine is FERGDVINPIRUDR-UHFFFAOYSA-N. |