{1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol
Modify Date: 2026-08-01 06:40:25
![{1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol Structure](https://www.chemsrc.com/extcaspic/368/2229013-85-6.png)
{1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol structure
|
Common Name | {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol | ||
|---|---|---|---|---|
| CAS Number | 2229013-85-6 | Molecular Weight | 275.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12BrClO |
|---|---|
| Molecular Weight | 275.57 |
| InChIKey | ZOFSIQDTQPRBRT-UHFFFAOYSA-N |
| SMILES | OCC1(Cc2ccc(Cl)c(Br)c2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229013-85-6? |
| A: Chinese name of 2229013-85-6 is 2229013-85-6. |
| Q: What is the English name of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol? |
| A: The English name of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol is {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol. |
| Q: What is the InChIKey of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol? |
| A: InChIKey of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol is ZOFSIQDTQPRBRT-UHFFFAOYSA-N. |
| Q: What is the molecular weight of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol? |
| A: Molecular weight of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol is 275.57. |
| Q: What is the CAS number of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol? |
| A: CAS number of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol is 2229013-85-6. |
| Q: What is the molecular formula of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol? |
| A: Molecular formula of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol is C11H12BrClO. |
| Q: What is the SMILES notation of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol? |
| A: SMILES notation of {1-[(3-Bromo-4-chlorophenyl)methyl]cyclopropyl}methanol is OCC1(Cc2ccc(Cl)c(Br)c2)CC1. |