2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid
Modify Date: 2026-08-20 17:28:22
2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid structure
|
Common Name | 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2229022-12-0 | Molecular Weight | 242.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl2F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Cl2F2NO2 |
|---|---|
| Molecular Weight | 242.00 |
| InChIKey | VRSFLIBQFDYSME-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)c1c(Cl)cncc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid? |
| A: CAS number of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid is 2229022-12-0. |
| Q: What is the English name of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid? |
| A: The English name of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid is 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid. |
| Q: What is the Chinese name of 2229022-12-0? |
| A: Chinese name of 2229022-12-0 is 2229022-12-0. |
| Q: What is the molecular formula of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid? |
| A: Molecular formula of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid is C7H3Cl2F2NO2. |
| Q: What is the molecular weight of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid? |
| A: Molecular weight of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid is 242.00. |
| Q: What is the InChIKey of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid? |
| A: InChIKey of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid is VRSFLIBQFDYSME-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid? |
| A: SMILES notation of 2-(3,5-Dichloropyridin-4-yl)-2,2-difluoroacetic acid is O=C(O)C(F)(F)c1c(Cl)cncc1Cl. |