3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid
Modify Date: 2026-07-29 19:31:04
3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid structure
|
Common Name | 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2229080-86-6 | Molecular Weight | 264.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClF2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7ClF2O4 |
|---|---|
| Molecular Weight | 264.61 |
| InChIKey | UGHIXIXEHBRGHH-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(F)(F)c1cc(Cl)c2c(c1)OCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid? |
| A: InChIKey of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid is UGHIXIXEHBRGHH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid? |
| A: CAS number of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid is 2229080-86-6. |
| Q: What is the Chinese name of 2229080-86-6? |
| A: Chinese name of 2229080-86-6 is 2229080-86-6. |
| Q: What is the molecular formula of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid? |
| A: Molecular formula of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid is C10H7ClF2O4. |
| Q: What is the English name of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid? |
| A: The English name of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid is 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid. |
| Q: What is the molecular weight of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid? |
| A: Molecular weight of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid is 264.61. |
| Q: What is the SMILES notation of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid? |
| A: SMILES notation of 3-(7-Chloro-1,3-dioxaindan-5-yl)-3,3-difluoropropanoic acid is O=C(O)CC(F)(F)c1cc(Cl)c2c(c1)OCO2. |