2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol
Modify Date: 2026-07-27 14:12:20
2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol structure
|
Common Name | 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol | ||
|---|---|---|---|---|
| CAS Number | 2229087-00-5 | Molecular Weight | 223.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F4NO |
|---|---|
| Molecular Weight | 223.17 |
| InChIKey | BLENOZOUJWMPKO-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)Cc1cc(F)cc(F)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol? |
| A: CAS number of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol is 2229087-00-5. |
| Q: What is the molecular formula of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol? |
| A: Molecular formula of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol is C9H9F4NO. |
| Q: What is the SMILES notation of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol? |
| A: SMILES notation of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol is NCC(F)(F)Cc1cc(F)cc(F)c1O. |
| Q: What is the InChIKey of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol? |
| A: InChIKey of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol is BLENOZOUJWMPKO-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol? |
| A: The English name of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol is 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol. |
| Q: What is the Chinese name of 2229087-00-5? |
| A: Chinese name of 2229087-00-5 is 2229087-00-5. |
| Q: What is the molecular weight of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol? |
| A: Molecular weight of 2-(3-Amino-2,2-difluoropropyl)-4,6-difluorophenol is 223.17. |