naphthalene diimide structure
|
Common Name | naphthalene diimide | ||
|---|---|---|---|---|
| CAS Number | 22291-04-9 | Molecular Weight | 408.45000 | |
| Density | 1.336g/cm3 | Boiling Point | 590.8ºC at 760 mmHg | |
| Molecular Formula | C22H24N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | N,N'-bis[(2-N,N-dimethylaminoethyl)]-1,4,6,8-naphthalene diimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 590.8ºC at 760 mmHg |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.45000 |
| Flash Point | 263.1ºC |
| Exact Mass | 408.18000 |
| PSA | 84.62000 |
| LogP | 0.18880 |
| Vapour Pressure | 6.23E-14mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | HPJFXFRNEJHDFR-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCN(C)C)C3=O |
|
~89%
naphthalene diimide CAS#:22291-04-9 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 9, # 8 p. 2015 - 2024 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Naphthalene diimide |