4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione
Modify Date: 2026-08-03 21:45:52
4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione structure
|
Common Name | 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 2229110-55-6 | Molecular Weight | 232.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O4 |
|---|---|
| Molecular Weight | 232.23 |
| InChIKey | ZPWHYFATOXGJCN-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc3c(c2)CCO3)CC(=O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione? |
| A: Molecular weight of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione is 232.23. |
| Q: What is the English name of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione? |
| A: The English name of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione is 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione. |
| Q: What is the CAS number of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione? |
| A: CAS number of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione is 2229110-55-6. |
| Q: What is the InChIKey of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione? |
| A: InChIKey of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione is ZPWHYFATOXGJCN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229110-55-6? |
| A: Chinese name of 2229110-55-6 is 2229110-55-6. |
| Q: What is the molecular formula of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione? |
| A: Molecular formula of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione is C13H12O4. |
| Q: What is the SMILES notation of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione? |
| A: SMILES notation of 4-(2,3-Dihydro-1-benzofuran-5-yl)oxane-2,6-dione is O=C1CC(c2ccc3c(c2)CCO3)CC(=O)O1. |