3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol
Modify Date: 2025-09-22 16:10:59
3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol structure
|
Common Name | 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2229111-04-8 | Molecular Weight | 214.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F2O2 |
|---|---|
| Molecular Weight | 214.21 |
| InChIKey | OGRAOLMHAVFDGO-UHFFFAOYSA-N |
| SMILES | OC(Cc1ccc2c(c1)CCO2)C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229111-04-8? |
| A: Chinese name of 2229111-04-8 is 2229111-04-8. |
| Q: What is the molecular formula of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol? |
| A: Molecular formula of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol is C11H12F2O2. |
| Q: What is the InChIKey of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol? |
| A: InChIKey of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol is OGRAOLMHAVFDGO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol? |
| A: Molecular weight of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol is 214.21. |
| Q: What is the CAS number of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol? |
| A: CAS number of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol is 2229111-04-8. |
| Q: What is the SMILES notation of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol? |
| A: SMILES notation of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol is OC(Cc1ccc2c(c1)CCO2)C(F)F. |
| Q: What is the English name of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol? |
| A: The English name of 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol is 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,1-difluoropropan-2-ol. |