3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine
Modify Date: 2026-08-14 12:39:28
3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine structure
|
Common Name | 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2229151-68-0 | Molecular Weight | 209.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23N3 |
|---|---|
| Molecular Weight | 209.33 |
| InChIKey | VVBMUSORRKVZEW-UHFFFAOYSA-N |
| SMILES | CCn1nc(C)c(CC(C)(C)CN)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine? |
| A: CAS number of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine is 2229151-68-0. |
| Q: What is the Chinese name of 2229151-68-0? |
| A: Chinese name of 2229151-68-0 is 2229151-68-0. |
| Q: What is the InChIKey of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine? |
| A: InChIKey of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine is VVBMUSORRKVZEW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine? |
| A: SMILES notation of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine is CCn1nc(C)c(CC(C)(C)CN)c1C. |
| Q: What is the molecular formula of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine? |
| A: Molecular formula of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine is C12H23N3. |
| Q: What is the English name of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine? |
| A: The English name of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine is 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine. |
| Q: What is the molecular weight of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine? |
| A: Molecular weight of 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-2,2-dimethylpropan-1-amine is 209.33. |