3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol
Modify Date: 2026-07-30 20:33:26
3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol structure
|
Common Name | 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2229159-93-5 | Molecular Weight | 171.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H21NO |
|---|---|
| Molecular Weight | 171.28 |
| InChIKey | LXKGDXBVOAEIDC-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(C)(C)C1(N)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229159-93-5? |
| A: Chinese name of 2229159-93-5 is 2229159-93-5. |
| Q: What is the InChIKey of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol? |
| A: InChIKey of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol is LXKGDXBVOAEIDC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol? |
| A: Molecular weight of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol is 171.28. |
| Q: What is the CAS number of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol? |
| A: CAS number of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol is 2229159-93-5. |
| Q: What is the molecular formula of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol? |
| A: Molecular formula of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol is C10H21NO. |
| Q: What is the SMILES notation of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol? |
| A: SMILES notation of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol is CC(C)(CO)C(C)(C)C1(N)CC1. |
| Q: What is the English name of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol? |
| A: The English name of 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol is 3-(1-Aminocyclopropyl)-2,2,3-trimethylbutan-1-ol. |