3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol
Modify Date: 2025-09-30 22:39:33
3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol structure
|
Common Name | 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 2229166-72-5 | Molecular Weight | 240.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8ClF3O2 |
|---|---|
| Molecular Weight | 240.60 |
| InChIKey | MGFCNONNGNNQKU-UHFFFAOYSA-N |
| SMILES | Oc1cccc(Cl)c1CC(O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol? |
| A: SMILES notation of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol is Oc1cccc(Cl)c1CC(O)C(F)(F)F. |
| Q: What is the CAS number of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol? |
| A: CAS number of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol is 2229166-72-5. |
| Q: What is the molecular weight of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol? |
| A: Molecular weight of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol is 240.60. |
| Q: What is the English name of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol? |
| A: The English name of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol is 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol. |
| Q: What is the InChIKey of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol? |
| A: InChIKey of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol is MGFCNONNGNNQKU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol? |
| A: Molecular formula of 3-Chloro-2-(3,3,3-trifluoro-2-hydroxypropyl)phenol is C9H8ClF3O2. |
| Q: What is the Chinese name of 2229166-72-5? |
| A: Chinese name of 2229166-72-5 is 2229166-72-5. |