N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine
Modify Date: 2026-07-20 13:39:59
![N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine Structure](https://www.chemsrc.com/extcaspic/340/2229186-36-9.png)
N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine structure
|
Common Name | N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2229186-36-9 | Molecular Weight | 239.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClF3NO |
|---|---|
| Molecular Weight | 239.62 |
| InChIKey | KRUCUXKSIYSIGX-UHFFFAOYSA-N |
| SMILES | CN(O)Cc1cc(Cl)cc(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine? |
| A: The English name of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine is N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine. |
| Q: What is the Chinese name of 2229186-36-9? |
| A: Chinese name of 2229186-36-9 is 2229186-36-9. |
| Q: What is the SMILES notation of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine? |
| A: SMILES notation of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine is CN(O)Cc1cc(Cl)cc(C(F)(F)F)c1. |
| Q: What is the CAS number of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine? |
| A: CAS number of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine is 2229186-36-9. |
| Q: What is the molecular weight of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine? |
| A: Molecular weight of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine is 239.62. |
| Q: What is the molecular formula of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine? |
| A: Molecular formula of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine is C9H9ClF3NO. |
| Q: What is the InChIKey of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine? |
| A: InChIKey of N-{[3-chloro-5-(trifluoromethyl)phenyl]methyl}-N-methylhydroxylamine is KRUCUXKSIYSIGX-UHFFFAOYSA-N. |