5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine
Modify Date: 2025-09-17 19:08:29
5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine structure
|
Common Name | 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 2229187-93-1 | Molecular Weight | 205.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11N3O2 |
|---|---|
| Molecular Weight | 205.21 |
| InChIKey | FBHQTGBQHNBSFD-UHFFFAOYSA-N |
| SMILES | COc1ncc(-c2cc(N)no2)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine? |
| A: Molecular weight of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine is 205.21. |
| Q: What is the molecular formula of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine? |
| A: Molecular formula of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine is C10H11N3O2. |
| Q: What is the Chinese name of 2229187-93-1? |
| A: Chinese name of 2229187-93-1 is 2229187-93-1. |
| Q: What is the CAS number of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine? |
| A: CAS number of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine is 2229187-93-1. |
| Q: What is the SMILES notation of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine? |
| A: SMILES notation of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine is COc1ncc(-c2cc(N)no2)cc1C. |
| Q: What is the InChIKey of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine? |
| A: InChIKey of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine is FBHQTGBQHNBSFD-UHFFFAOYSA-N. |
| Q: What is the English name of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine? |
| A: The English name of 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine is 5-(6-Methoxy-5-methylpyridin-3-yl)-1,2-oxazol-3-amine. |