[1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol
Modify Date: 2026-07-03 18:47:40
![[1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol Structure](https://www.chemsrc.com/extcaspic/165/2229202-25-7.png)
[1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol structure
|
Common Name | [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 2229202-25-7 | Molecular Weight | 198.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F2O |
|---|---|
| Molecular Weight | 198.21 |
| InChIKey | QMDTWFSZCJLOER-UHFFFAOYSA-N |
| SMILES | Cc1ccc(F)c(C2(CO)CC2)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol? |
| A: InChIKey of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol is QMDTWFSZCJLOER-UHFFFAOYSA-N. |
| Q: What is the CAS number of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol? |
| A: CAS number of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol is 2229202-25-7. |
| Q: What is the Chinese name of 2229202-25-7? |
| A: Chinese name of 2229202-25-7 is 2229202-25-7. |
| Q: What is the molecular formula of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol? |
| A: Molecular formula of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol is C11H12F2O. |
| Q: What is the SMILES notation of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol? |
| A: SMILES notation of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol is Cc1ccc(F)c(C2(CO)CC2)c1F. |
| Q: What is the molecular weight of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol? |
| A: Molecular weight of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol is 198.21. |
| Q: What is the English name of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol? |
| A: The English name of [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol is [1-(2,6-Difluoro-3-methylphenyl)cyclopropyl]methanol. |