4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol
Modify Date: 2025-10-09 14:03:24
![4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol Structure](https://www.chemsrc.com/extcaspic/307/2229208-41-5.png)
4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol structure
|
Common Name | 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 2229208-41-5 | Molecular Weight | 192.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O2 |
|---|---|
| Molecular Weight | 192.25 |
| InChIKey | MBQNSJSRXZACNO-UHFFFAOYSA-N |
| SMILES | CC1(C)CC1(CO)c1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol? |
| A: InChIKey of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol is MBQNSJSRXZACNO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol? |
| A: Molecular weight of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol is 192.25. |
| Q: What is the English name of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol? |
| A: The English name of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol is 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol. |
| Q: What is the Chinese name of 2229208-41-5? |
| A: Chinese name of 2229208-41-5 is 2229208-41-5. |
| Q: What is the molecular formula of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol? |
| A: Molecular formula of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol is C12H16O2. |
| Q: What is the SMILES notation of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol? |
| A: SMILES notation of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol is CC1(C)CC1(CO)c1ccc(O)cc1. |
| Q: What is the CAS number of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol? |
| A: CAS number of 4-[1-(Hydroxymethyl)-2,2-dimethylcyclopropyl]phenol is 2229208-41-5. |