5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine
Modify Date: 2026-08-08 07:00:14
5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine structure
|
Common Name | 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 2229210-06-2 | Molecular Weight | 239.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11F2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11F2N3O |
|---|---|
| Molecular Weight | 239.22 |
| InChIKey | XSEXVWJALCSFJT-UHFFFAOYSA-N |
| SMILES | COc1cc(F)c(F)cc1-c1c(N)cnn1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine? |
| A: Molecular formula of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine is C11H11F2N3O. |
| Q: What is the CAS number of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine? |
| A: CAS number of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine is 2229210-06-2. |
| Q: What is the SMILES notation of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine? |
| A: SMILES notation of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine is COc1cc(F)c(F)cc1-c1c(N)cnn1C. |
| Q: What is the InChIKey of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine? |
| A: InChIKey of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine is XSEXVWJALCSFJT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229210-06-2? |
| A: Chinese name of 2229210-06-2 is 2229210-06-2. |
| Q: What is the English name of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine? |
| A: The English name of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine is 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine. |
| Q: What is the molecular weight of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine? |
| A: Molecular weight of 5-(4,5-difluoro-2-methoxyphenyl)-1-methyl-1H-pyrazol-4-amine is 239.22. |