4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline
Modify Date: 2026-09-27 14:51:15
![4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline Structure](https://www.chemsrc.com/extcaspic/025/2229213-73-2.png)
4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline structure
|
Common Name | 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 2229213-73-2 | Molecular Weight | 238.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22N2O2 |
|---|---|
| Molecular Weight | 238.33 |
| InChIKey | SHXRHVUTNWIIID-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C(C)ON)c(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229213-73-2? |
| A: Chinese name of 2229213-73-2 is 2229213-73-2. |
| Q: What is the molecular weight of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline? |
| A: Molecular weight of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline is 238.33. |
| Q: What is the InChIKey of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline? |
| A: InChIKey of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline is SHXRHVUTNWIIID-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline? |
| A: CAS number of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline is 2229213-73-2. |
| Q: What is the molecular formula of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline? |
| A: Molecular formula of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline is C13H22N2O2. |
| Q: What is the SMILES notation of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline? |
| A: SMILES notation of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline is CCN(CC)c1ccc(C(C)ON)c(OC)c1. |
| Q: What is the English name of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline? |
| A: The English name of 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline is 4-[1-(aminooxy)ethyl]-N,N-diethyl-3-methoxyaniline. |