methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate
Modify Date: 2026-10-05 13:27:00
methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate structure
|
Common Name | methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2229239-75-0 | Molecular Weight | 260.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2O4S |
|---|---|
| Molecular Weight | 260.31 |
| InChIKey | UUGNWPVZJTWLNC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(CS(N)(=O)=O)c(C)n(C)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate? |
| A: The English name of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate is methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate. |
| Q: What is the CAS number of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate? |
| A: CAS number of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate is 2229239-75-0. |
| Q: What is the molecular weight of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate? |
| A: Molecular weight of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate is 260.31. |
| Q: What is the Chinese name of 2229239-75-0? |
| A: Chinese name of 2229239-75-0 is 2229239-75-0. |
| Q: What is the InChIKey of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate? |
| A: InChIKey of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate is UUGNWPVZJTWLNC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate? |
| A: Molecular formula of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate is C10H16N2O4S. |
| Q: What is the SMILES notation of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate? |
| A: SMILES notation of methyl 1,2,5-trimethyl-4-(sulfamoylmethyl)-1H-pyrrole-3-carboxylate is COC(=O)c1c(CS(N)(=O)=O)c(C)n(C)c1C. |