3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol
Modify Date: 2025-09-17 19:59:17
3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol structure
|
Common Name | 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2229256-65-7 | Molecular Weight | 230.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20F2O |
|---|---|
| Molecular Weight | 230.29 |
| InChIKey | FSPDQBXFZDGTDH-UHFFFAOYSA-N |
| SMILES | OC(CC12CC3CC(CC(C3)C1)C2)C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol? |
| A: The English name of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol is 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol. |
| Q: What is the InChIKey of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol? |
| A: InChIKey of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol is FSPDQBXFZDGTDH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol? |
| A: Molecular formula of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol is C13H20F2O. |
| Q: What is the molecular weight of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol? |
| A: Molecular weight of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol is 230.29. |
| Q: What is the CAS number of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol? |
| A: CAS number of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol is 2229256-65-7. |
| Q: What is the Chinese name of 2229256-65-7? |
| A: Chinese name of 2229256-65-7 is 2229256-65-7. |
| Q: What is the SMILES notation of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol? |
| A: SMILES notation of 3-(Adamantan-1-yl)-1,1-difluoropropan-2-ol is OC(CC12CC3CC(CC(C3)C1)C2)C(F)F. |