[3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine
Modify Date: 2026-07-27 21:08:09
![[3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine Structure](https://www.chemsrc.com/extcaspic/025/2229268-65-7.png)
[3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine structure
|
Common Name | [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2229268-65-7 | Molecular Weight | 215.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N3 |
|---|---|
| Molecular Weight | 215.29 |
| InChIKey | AOUWOVMZROAVRW-UHFFFAOYSA-N |
| SMILES | CC1(C)C(CN)C1c1[nH]nc2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine? |
| A: The English name of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine is [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine. |
| Q: What is the CAS number of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine? |
| A: CAS number of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine is 2229268-65-7. |
| Q: What is the Chinese name of 2229268-65-7? |
| A: Chinese name of 2229268-65-7 is 2229268-65-7. |
| Q: What is the molecular formula of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine? |
| A: Molecular formula of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine is C13H17N3. |
| Q: What is the SMILES notation of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine? |
| A: SMILES notation of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine is CC1(C)C(CN)C1c1[nH]nc2ccccc12. |
| Q: What is the InChIKey of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine? |
| A: InChIKey of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine is AOUWOVMZROAVRW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine? |
| A: Molecular weight of [3-(1H-indazol-3-yl)-2,2-dimethylcyclopropyl]methanamine is 215.29. |