methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate
Modify Date: 2026-07-03 14:35:59
methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate structure
|
Common Name | methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2229268-78-2 | Molecular Weight | 208.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N2O2 |
|---|---|
| Molecular Weight | 208.26 |
| InChIKey | XXGVPLFLAHFZHB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C2CCCN2)n1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate? |
| A: Molecular formula of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate is C11H16N2O2. |
| Q: What is the English name of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate? |
| A: The English name of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate is methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate. |
| Q: What is the molecular weight of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate? |
| A: Molecular weight of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate is 208.26. |
| Q: What is the Chinese name of 2229268-78-2? |
| A: Chinese name of 2229268-78-2 is 2229268-78-2. |
| Q: What is the InChIKey of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate? |
| A: InChIKey of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate is XXGVPLFLAHFZHB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate? |
| A: SMILES notation of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate is COC(=O)c1ccc(C2CCCN2)n1C. |
| Q: What is the CAS number of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate? |
| A: CAS number of methyl 1-methyl-5-(pyrrolidin-2-yl)-1H-pyrrole-2-carboxylate is 2229268-78-2. |