5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one
Modify Date: 2026-07-08 16:24:14
5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one structure
|
Common Name | 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 2229274-17-1 | Molecular Weight | 258.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8BrNO3 |
|---|---|
| Molecular Weight | 258.07 |
| InChIKey | OHRCWBQWFRXEOV-UHFFFAOYSA-N |
| SMILES | O=C1NCC(c2cccc(Br)c2O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one? |
| A: SMILES notation of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one is O=C1NCC(c2cccc(Br)c2O)O1. |
| Q: What is the Chinese name of 2229274-17-1? |
| A: Chinese name of 2229274-17-1 is 2229274-17-1. |
| Q: What is the molecular weight of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one? |
| A: Molecular weight of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one is 258.07. |
| Q: What is the molecular formula of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one? |
| A: Molecular formula of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one is C9H8BrNO3. |
| Q: What is the CAS number of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one? |
| A: CAS number of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one is 2229274-17-1. |
| Q: What is the InChIKey of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one? |
| A: InChIKey of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one is OHRCWBQWFRXEOV-UHFFFAOYSA-N. |
| Q: What is the English name of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one? |
| A: The English name of 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one is 5-(3-Bromo-2-hydroxyphenyl)-1,3-oxazolidin-2-one. |