Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate
Modify Date: 2026-07-08 14:35:41
Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate structure
|
Common Name | Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 2229285-00-9 | Molecular Weight | 229.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NO3 |
|---|---|
| Molecular Weight | 229.23 |
| InChIKey | VMSALWOJFWQADY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C2(C#N)CC(=O)C2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate? |
| A: Molecular formula of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate is C13H11NO3. |
| Q: What is the Chinese name of 2229285-00-9? |
| A: Chinese name of 2229285-00-9 is 2229285-00-9. |
| Q: What is the CAS number of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate? |
| A: CAS number of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate is 2229285-00-9. |
| Q: What is the molecular weight of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate? |
| A: Molecular weight of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate is 229.23. |
| Q: What is the InChIKey of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate? |
| A: InChIKey of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate is VMSALWOJFWQADY-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate? |
| A: The English name of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate is Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate. |
| Q: What is the SMILES notation of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate? |
| A: SMILES notation of Methyl 4-(1-cyano-3-oxocyclobutyl)benzoate is COC(=O)c1ccc(C2(C#N)CC(=O)C2)cc1. |