{1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine
Modify Date: 2025-09-24 10:18:37
![{1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine Structure](https://www.chemsrc.com/extcaspic/271/2229289-20-5.png)
{1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine structure
|
Common Name | {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine | ||
|---|---|---|---|---|
| CAS Number | 2229289-20-5 | Molecular Weight | 231.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12Cl2N2 |
|---|---|
| Molecular Weight | 231.12 |
| InChIKey | YVHBCIXRMKLAOF-UHFFFAOYSA-N |
| SMILES | NCC1(Cc2cnc(Cl)c(Cl)c2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine? |
| A: SMILES notation of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine is NCC1(Cc2cnc(Cl)c(Cl)c2)CC1. |
| Q: What is the molecular formula of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine? |
| A: Molecular formula of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine is C10H12Cl2N2. |
| Q: What is the molecular weight of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine? |
| A: Molecular weight of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine is 231.12. |
| Q: What is the English name of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine? |
| A: The English name of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine is {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine. |
| Q: What is the InChIKey of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine? |
| A: InChIKey of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine is YVHBCIXRMKLAOF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229289-20-5? |
| A: Chinese name of 2229289-20-5 is 2229289-20-5. |
| Q: What is the CAS number of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine? |
| A: CAS number of {1-[(5,6-Dichloropyridin-3-yl)methyl]cyclopropyl}methanamine is 2229289-20-5. |