4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid
Modify Date: 2026-07-07 20:23:53
![4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/352/2229293-47-2.png)
4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid structure
|
Common Name | 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2229293-47-2 | Molecular Weight | 277.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21F2NO3 |
|---|---|
| Molecular Weight | 277.31 |
| InChIKey | IQNGFBJLSKYLNA-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(CCN2CCOCC2)CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid? |
| A: Molecular formula of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid is C13H21F2NO3. |
| Q: What is the SMILES notation of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid? |
| A: SMILES notation of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid is O=C(O)C1(CCN2CCOCC2)CCC(F)(F)CC1. |
| Q: What is the InChIKey of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid? |
| A: InChIKey of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid is IQNGFBJLSKYLNA-UHFFFAOYSA-N. |
| Q: What is the English name of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid? |
| A: The English name of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid is 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid. |
| Q: What is the Chinese name of 2229293-47-2? |
| A: Chinese name of 2229293-47-2 is 2229293-47-2. |
| Q: What is the molecular weight of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid? |
| A: Molecular weight of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid is 277.31. |
| Q: What is the CAS number of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid? |
| A: CAS number of 4,4-Difluoro-1-[2-(morpholin-4-yl)ethyl]cyclohexane-1-carboxylic acid is 2229293-47-2. |