1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole
Modify Date: 2026-07-04 15:30:57
![1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole Structure](https://www.chemsrc.com/extcaspic/381/2229295-90-1.png)
1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole structure
|
Common Name | 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 2229295-90-1 | Molecular Weight | 229.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O |
|---|---|
| Molecular Weight | 229.28 |
| InChIKey | HEKZKJUJXVKOOE-UHFFFAOYSA-N |
| SMILES | CC1(Oc2ccccc2-n2cccn2)CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole? |
| A: SMILES notation of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole is CC1(Oc2ccccc2-n2cccn2)CNC1. |
| Q: What is the CAS number of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole? |
| A: CAS number of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole is 2229295-90-1. |
| Q: What is the Chinese name of 2229295-90-1? |
| A: Chinese name of 2229295-90-1 is 2229295-90-1. |
| Q: What is the molecular weight of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole? |
| A: Molecular weight of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole is 229.28. |
| Q: What is the molecular formula of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole? |
| A: Molecular formula of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole is C13H15N3O. |
| Q: What is the English name of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole? |
| A: The English name of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole is 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole. |
| Q: What is the InChIKey of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole? |
| A: InChIKey of 1-{2-[(3-methylazetidin-3-yl)oxy]phenyl}-1H-pyrazole is HEKZKJUJXVKOOE-UHFFFAOYSA-N. |