3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine
Modify Date: 2026-08-05 11:11:10
![3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine Structure](https://www.chemsrc.com/extcaspic/216/2229298-00-2.png)
3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine structure
|
Common Name | 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine | ||
|---|---|---|---|---|
| CAS Number | 2229298-00-2 | Molecular Weight | 235.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25N3 |
|---|---|
| Molecular Weight | 235.37 |
| InChIKey | WGLGZIZRZHHBMW-UHFFFAOYSA-N |
| SMILES | Cc1nn(C(C)C)c(C)c1CC1CCCNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229298-00-2? |
| A: Chinese name of 2229298-00-2 is 2229298-00-2. |
| Q: What is the SMILES notation of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine? |
| A: SMILES notation of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine is Cc1nn(C(C)C)c(C)c1CC1CCCNC1. |
| Q: What is the molecular weight of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine? |
| A: Molecular weight of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine is 235.37. |
| Q: What is the English name of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine? |
| A: The English name of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine is 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine. |
| Q: What is the InChIKey of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine? |
| A: InChIKey of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine is WGLGZIZRZHHBMW-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine? |
| A: CAS number of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine is 2229298-00-2. |
| Q: What is the molecular formula of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine? |
| A: Molecular formula of 3-{[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]methyl}piperidine is C14H25N3. |