3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid
Modify Date: 2026-08-21 18:31:47
3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid structure
|
Common Name | 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2229312-64-3 | Molecular Weight | 208.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25 |
| InChIKey | XZDFECYQXABXDX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C2C(C(=O)O)C2(C)C)c(C)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid? |
| A: CAS number of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid is 2229312-64-3. |
| Q: What is the molecular formula of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid? |
| A: Molecular formula of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid is C12H16O3. |
| Q: What is the InChIKey of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid? |
| A: InChIKey of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid is XZDFECYQXABXDX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229312-64-3? |
| A: Chinese name of 2229312-64-3 is 2229312-64-3. |
| Q: What is the English name of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid? |
| A: The English name of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid is 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid. |
| Q: What is the SMILES notation of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid? |
| A: SMILES notation of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid is Cc1cc(C2C(C(=O)O)C2(C)C)c(C)o1. |
| Q: What is the molecular weight of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid? |
| A: Molecular weight of 3-(2,5-Dimethylfuran-3-yl)-2,2-dimethylcyclopropane-1-carboxylic acid is 208.25. |