(4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate
Modify Date: 2026-07-23 19:51:04
(4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate structure
|
Common Name | (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate | ||
|---|---|---|---|---|
| CAS Number | 2229338-63-8 | Molecular Weight | 234.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10N2O3S2 |
|---|---|
| Molecular Weight | 234.3 |
| InChIKey | KVVDFKZYPMXSSQ-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)OCc1scnc1C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate? |
| A: SMILES notation of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate is NS(=O)(=O)OCc1scnc1C1CC1. |
| Q: What is the English name of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate? |
| A: The English name of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate is (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate. |
| Q: What is the molecular formula of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate? |
| A: Molecular formula of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate is C7H10N2O3S2. |
| Q: What is the CAS number of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate? |
| A: CAS number of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate is 2229338-63-8. |
| Q: What is the molecular weight of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate? |
| A: Molecular weight of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate is 234.3. |
| Q: What is the Chinese name of 2229338-63-8? |
| A: Chinese name of 2229338-63-8 is 2229338-63-8. |
| Q: What is the InChIKey of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate? |
| A: InChIKey of (4-Cyclopropyl-1,3-thiazol-5-yl)methyl sulfamate is KVVDFKZYPMXSSQ-UHFFFAOYSA-N. |