(2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate
Modify Date: 2026-08-11 15:43:57
(2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate structure
|
Common Name | (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate | ||
|---|---|---|---|---|
| CAS Number | 2229358-20-5 | Molecular Weight | 249.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12FNO4S |
|---|---|
| Molecular Weight | 249.26 |
| InChIKey | DFHFRJSVUSRVNF-UHFFFAOYSA-N |
| SMILES | COc1cc(C)cc(F)c1COS(N)(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229358-20-5? |
| A: Chinese name of 2229358-20-5 is 2229358-20-5. |
| Q: What is the SMILES notation of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate? |
| A: SMILES notation of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate is COc1cc(C)cc(F)c1COS(N)(=O)=O. |
| Q: What is the molecular formula of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate? |
| A: Molecular formula of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate is C9H12FNO4S. |
| Q: What is the English name of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate? |
| A: The English name of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate is (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate. |
| Q: What is the InChIKey of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate? |
| A: InChIKey of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate is DFHFRJSVUSRVNF-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate? |
| A: CAS number of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate is 2229358-20-5. |
| Q: What is the molecular weight of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate? |
| A: Molecular weight of (2-Fluoro-6-methoxy-4-methylphenyl)methyl sulfamate is 249.26. |