5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine structure
|
Common Name | 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 2229386-33-6 | Molecular Weight | 214.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5F3N2O |
|---|---|
| Molecular Weight | 214.14 |
| InChIKey | IHPRZCHKLUQZON-UHFFFAOYSA-N |
| SMILES | Nc1cnoc1-c1cc(F)c(F)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229386-33-6? |
| A: Chinese name of 2229386-33-6 is 2229386-33-6. |
| Q: What is the English name of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine? |
| A: The English name of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine is 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine. |
| Q: What is the SMILES notation of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine? |
| A: SMILES notation of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine is Nc1cnoc1-c1cc(F)c(F)cc1F. |
| Q: What is the molecular formula of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine? |
| A: Molecular formula of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine is C9H5F3N2O. |
| Q: What is the InChIKey of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine? |
| A: InChIKey of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine is IHPRZCHKLUQZON-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine? |
| A: Molecular weight of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine is 214.14. |
| Q: What is the CAS number of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine? |
| A: CAS number of 5-(2,4,5-Trifluorophenyl)-1,2-oxazol-4-amine is 2229386-33-6. |