Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate
Modify Date: 2026-08-21 06:44:22
Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate structure
|
Common Name | Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 2229396-47-6 | Molecular Weight | 234.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14O4 |
|---|---|
| Molecular Weight | 234.25 |
| InChIKey | KTBDNZHLJTVYMV-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)Cc1ccc2c(c1)CCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate? |
| A: CAS number of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate is 2229396-47-6. |
| Q: What is the molecular formula of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate? |
| A: Molecular formula of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate is C13H14O4. |
| Q: What is the Chinese name of 2229396-47-6? |
| A: Chinese name of 2229396-47-6 is 2229396-47-6. |
| Q: What is the SMILES notation of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate? |
| A: SMILES notation of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate is COC(=O)CC(=O)Cc1ccc2c(c1)CCO2. |
| Q: What is the InChIKey of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate? |
| A: InChIKey of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate is KTBDNZHLJTVYMV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate? |
| A: Molecular weight of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate is 234.25. |
| Q: What is the English name of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate? |
| A: The English name of Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate is Methyl 4-(2,3-dihydro-1-benzofuran-5-yl)-3-oxobutanoate. |