5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine
Modify Date: 2025-10-12 17:03:50
5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine structure
|
Common Name | 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2229398-28-9 | Molecular Weight | 177.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11N3O |
|---|---|
| Molecular Weight | 177.20 |
| InChIKey | VPHBYOJEMCOTOU-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cnc(N)o2)c(C)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine? |
| A: The English name of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine is 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine. |
| Q: What is the SMILES notation of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine? |
| A: SMILES notation of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine is Cc1cc(-c2cnc(N)o2)c(C)[nH]1. |
| Q: What is the InChIKey of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine? |
| A: InChIKey of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine is VPHBYOJEMCOTOU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine? |
| A: Molecular weight of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine is 177.20. |
| Q: What is the molecular formula of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine? |
| A: Molecular formula of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine is C9H11N3O. |
| Q: What is the Chinese name of 2229398-28-9? |
| A: Chinese name of 2229398-28-9 is 2229398-28-9. |
| Q: What is the CAS number of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine? |
| A: CAS number of 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1,3-oxazol-2-amine is 2229398-28-9. |