4-Chloro-2-nitrophenyl sulfamate
Modify Date: 2026-07-17 17:10:11
4-Chloro-2-nitrophenyl sulfamate structure
|
Common Name | 4-Chloro-2-nitrophenyl sulfamate | ||
|---|---|---|---|---|
| CAS Number | 2229399-45-3 | Molecular Weight | 252.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5ClN2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-2-nitrophenyl sulfamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5ClN2O5S |
|---|---|
| Molecular Weight | 252.63 |
| InChIKey | FWVUWSLWJFVJJL-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)Oc1ccc(Cl)cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Chloro-2-nitrophenyl sulfamate? |
| A: Molecular formula of 4-Chloro-2-nitrophenyl sulfamate is C6H5ClN2O5S. |
| Q: What is the molecular weight of 4-Chloro-2-nitrophenyl sulfamate? |
| A: Molecular weight of 4-Chloro-2-nitrophenyl sulfamate is 252.63. |
| Q: What is the InChIKey of 4-Chloro-2-nitrophenyl sulfamate? |
| A: InChIKey of 4-Chloro-2-nitrophenyl sulfamate is FWVUWSLWJFVJJL-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Chloro-2-nitrophenyl sulfamate? |
| A: CAS number of 4-Chloro-2-nitrophenyl sulfamate is 2229399-45-3. |
| Q: What is the SMILES notation of 4-Chloro-2-nitrophenyl sulfamate? |
| A: SMILES notation of 4-Chloro-2-nitrophenyl sulfamate is NS(=O)(=O)Oc1ccc(Cl)cc1[N+](=O)[O-]. |
| Q: What is the English name of 4-Chloro-2-nitrophenyl sulfamate? |
| A: The English name of 4-Chloro-2-nitrophenyl sulfamate is 4-Chloro-2-nitrophenyl sulfamate. |
| Q: What is the Chinese name of 2229399-45-3? |
| A: Chinese name of 2229399-45-3 is 2229399-45-3. |