3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid
Modify Date: 2025-11-02 10:34:27
3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid structure
|
Common Name | 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2229415-49-8 | Molecular Weight | 241.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12ClNO3 |
|---|---|
| Molecular Weight | 241.67 |
| InChIKey | GEJSVEKJCLYUNF-UHFFFAOYSA-N |
| SMILES | NC1CC(C(=O)O)(c2ccc(O)c(Cl)c2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid? |
| A: Molecular formula of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid is C11H12ClNO3. |
| Q: What is the molecular weight of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid? |
| A: Molecular weight of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid is 241.67. |
| Q: What is the English name of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid? |
| A: The English name of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid is 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid. |
| Q: What is the CAS number of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid? |
| A: CAS number of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid is 2229415-49-8. |
| Q: What is the Chinese name of 2229415-49-8? |
| A: Chinese name of 2229415-49-8 is 2229415-49-8. |
| Q: What is the SMILES notation of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid? |
| A: SMILES notation of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid is NC1CC(C(=O)O)(c2ccc(O)c(Cl)c2)C1. |
| Q: What is the InChIKey of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid? |
| A: InChIKey of 3-Amino-1-(3-chloro-4-hydroxyphenyl)cyclobutane-1-carboxylic acid is GEJSVEKJCLYUNF-UHFFFAOYSA-N. |