[1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine structure
|
Common Name | [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2229453-01-2 | Molecular Weight | 259.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H27F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H27F2N |
|---|---|
| Molecular Weight | 259.38 |
| InChIKey | DTDBXQBMZQVPDU-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(C2(CN)CCC(F)(F)CC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2229453-01-2? |
| A: Chinese name of 2229453-01-2 is 2229453-01-2. |
| Q: What is the CAS number of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine? |
| A: CAS number of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine is 2229453-01-2. |
| Q: What is the English name of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine? |
| A: The English name of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine is [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine. |
| Q: What is the molecular formula of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine? |
| A: Molecular formula of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine is C15H27F2N. |
| Q: What is the molecular weight of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine? |
| A: Molecular weight of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine is 259.38. |
| Q: What is the InChIKey of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine? |
| A: InChIKey of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine is DTDBXQBMZQVPDU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine? |
| A: SMILES notation of [1-(4,4-Dimethylcyclohexyl)-4,4-difluorocyclohexyl]methanamine is CC1(C)CCC(C2(CN)CCC(F)(F)CC2)CC1. |