(2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine
Modify Date: 2026-07-04 13:56:38
![(2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine Structure](https://www.chemsrc.com/extcaspic/285/2229453-30-7.png)
(2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine structure
|
Common Name | (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine | ||
|---|---|---|---|---|
| CAS Number | 2229453-30-7 | Molecular Weight | 193.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23N |
|---|---|
| Molecular Weight | 193.33 |
| InChIKey | GYZMKSDBCOYVPI-UHFFFAOYSA-N |
| SMILES | CNC(C)(C)C1=CCC2CC1C2(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine? |
| A: CAS number of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine is 2229453-30-7. |
| Q: What is the SMILES notation of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine? |
| A: SMILES notation of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine is CNC(C)(C)C1=CCC2CC1C2(C)C. |
| Q: What is the molecular weight of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine? |
| A: Molecular weight of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine is 193.33. |
| Q: What is the InChIKey of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine? |
| A: InChIKey of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine is GYZMKSDBCOYVPI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2229453-30-7? |
| A: Chinese name of 2229453-30-7 is 2229453-30-7. |
| Q: What is the English name of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine? |
| A: The English name of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine is (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine. |
| Q: What is the molecular formula of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine? |
| A: Molecular formula of (2-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}propan-2-yl)(methyl)amine is C13H23N. |