[3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine
Modify Date: 2026-07-12 14:21:37
![[3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine Structure](https://www.chemsrc.com/extcaspic/145/2229476-95-1.png)
[3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine structure
|
Common Name | [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2229476-95-1 | Molecular Weight | 217.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13F2NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13F2NS |
|---|---|
| Molecular Weight | 217.28 |
| InChIKey | ZYKSZNXAVIXUAZ-UHFFFAOYSA-N |
| SMILES | Cc1ccsc1C1(CN)CC(F)(F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine? |
| A: SMILES notation of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine is Cc1ccsc1C1(CN)CC(F)(F)C1. |
| Q: What is the Chinese name of 2229476-95-1? |
| A: Chinese name of 2229476-95-1 is 2229476-95-1. |
| Q: What is the InChIKey of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine? |
| A: InChIKey of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine is ZYKSZNXAVIXUAZ-UHFFFAOYSA-N. |
| Q: What is the English name of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine? |
| A: The English name of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine is [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine. |
| Q: What is the CAS number of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine? |
| A: CAS number of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine is 2229476-95-1. |
| Q: What is the molecular weight of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine? |
| A: Molecular weight of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine is 217.28. |
| Q: What is the molecular formula of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine? |
| A: Molecular formula of [3,3-Difluoro-1-(3-methylthiophen-2-yl)cyclobutyl]methanamine is C10H13F2NS. |