methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate
Modify Date: 2026-08-06 19:28:05
methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate structure
|
Common Name | methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2229491-90-9 | Molecular Weight | 221.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11N3O3 |
|---|---|
| Molecular Weight | 221.21 |
| InChIKey | KFDKUJDFDNVKQR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2cnc(N)o2)n1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate? |
| A: CAS number of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate is 2229491-90-9. |
| Q: What is the molecular formula of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate? |
| A: Molecular formula of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate is C10H11N3O3. |
| Q: What is the InChIKey of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate? |
| A: InChIKey of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate is KFDKUJDFDNVKQR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate? |
| A: SMILES notation of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate is COC(=O)c1ccc(-c2cnc(N)o2)n1C. |
| Q: What is the molecular weight of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate? |
| A: Molecular weight of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate is 221.21. |
| Q: What is the English name of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate? |
| A: The English name of methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate is methyl 5-(2-amino-1,3-oxazol-5-yl)-1-methyl-1H-pyrrole-2-carboxylate. |
| Q: What is the Chinese name of 2229491-90-9? |
| A: Chinese name of 2229491-90-9 is 2229491-90-9. |