2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol
Modify Date: 2025-09-05 20:40:01
2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol structure
|
Common Name | 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2229495-04-7 | Molecular Weight | 228.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5ClF4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5ClF4O |
|---|---|
| Molecular Weight | 228.57 |
| InChIKey | YYEOVLQEGSGANY-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)c1ccc(F)c(Cl)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol? |
| A: The English name of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol is 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol. |
| Q: What is the molecular formula of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol? |
| A: Molecular formula of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol is C8H5ClF4O. |
| Q: What is the Chinese name of 2229495-04-7? |
| A: Chinese name of 2229495-04-7 is 2229495-04-7. |
| Q: What is the molecular weight of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol? |
| A: Molecular weight of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol is 228.57. |
| Q: What is the CAS number of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol? |
| A: CAS number of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol is 2229495-04-7. |
| Q: What is the InChIKey of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol? |
| A: InChIKey of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol is YYEOVLQEGSGANY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol? |
| A: SMILES notation of 2-(3-Chloro-2,4-difluorophenyl)-2,2-difluoroethan-1-ol is OCC(F)(F)c1ccc(F)c(Cl)c1F. |