1,4-Naphthalenedione,2-[2-(2-benzothiazolyl)hydrazinyl]-3-chloro- structure
|
Common Name | 1,4-Naphthalenedione,2-[2-(2-benzothiazolyl)hydrazinyl]-3-chloro- | ||
|---|---|---|---|---|
| CAS Number | 22295-51-8 | Molecular Weight | 355.79800 | |
| Density | 1.56g/cm3 | Boiling Point | 497ºC at 760 mmHg | |
| Molecular Formula | C17H10ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | 2-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-3-chloronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 497ºC at 760 mmHg |
| Molecular Formula | C17H10ClN3O2S |
| Molecular Weight | 355.79800 |
| Flash Point | 254.4ºC |
| Exact Mass | 355.01800 |
| PSA | 102.56000 |
| LogP | 3.55520 |
| Vapour Pressure | 5.13E-10mmHg at 25°C |
| Index of Refraction | 1.759 |
| InChIKey | CCQMWWZQVDQENP-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)c(N=Nc2nc3ccccc3s2)c(O)c2ccccc12 |
|
~%
1,4-Naphthalene... CAS#:22295-51-8 |
| Literature: Prescott,B. Journal of Medicinal Chemistry, 1969 , vol. 12, # 1 p. 181 - 182 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-benzothiazol-2-ylazo-3-chloro-naphthalene-1,4-diol |